Products 1046535-04-9

CAS 1046535-04-9 is the registry number for Ethyl 2-(4-chlorophenyl)-2-(ethylamino)acetate hydrochloride. Offered by: Biosynth. Available pack sizes: 100mg, 1g.

Structural formula: {0} (CAS {1})

Ethyl 2-(4-chlorophenyl)-2-(ethylamino)acetate;hydrochloride (CAS 1046535-04-9) is a chemical compound with the molecular formula C12H17Cl2NO2 and a molecular weight of 278.17 g/mol. IUPAC name: ethyl 2-(4-chlorophenyl)-2-(ethylamino)acetate;hydrochloride. InChIKey: WXERWVLAKAIKJX-UHFFFAOYSA-N.

Identity
Molecular formulaC12H17Cl2NO2
Molecular weight278.17 g/mol
IUPAC nameethyl 2-(4-chlorophenyl)-2-(ethylamino)acetate;hydrochloride
InChIKeyWXERWVLAKAIKJX-UHFFFAOYSA-N
SMILESCCNC(C1=CC=C(C=C1)Cl)C(=O)OCC.Cl

Computed by PubChem (NCBI)