Products 1046831-99-5
CAS 1046831-99-5 is the registry number for 4,4,5,5-Tetramethyl-2-(5-methyl-1-cyclohexen-1-yl)-1,3,2-dioxaborolane. Offered by: TRC. Available pack sizes: 2,5g.
4,4,5,5-tetramethyl-2-(5-methylcyclohexen-1-yl)-1,3,2-dioxaborolane (CAS 1046831-99-5) is a chemical compound with the molecular formula C13H23BO2 and a molecular weight of 222.13 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-(5-methylcyclohexen-1-yl)-1,3,2-dioxaborolane. InChIKey: NWCZEVPFXFKMNT-UHFFFAOYSA-N.
| Molecular formula | C13H23BO2 |
|---|---|
| Molecular weight | 222.13 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-(5-methylcyclohexen-1-yl)-1,3,2-dioxaborolane |
| InChIKey | NWCZEVPFXFKMNT-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CCCC(C2)C |
Computed by PubChem (NCBI)