CAS 177949-94-9 appears in our catalog under these names: 2-(1-Cyclopentylvinyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98% mix TBC as stabilizer, 2-(1-Cyclopentylvinyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
2-(1-cyclopentylethenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 177949-94-9) is a chemical compound with the molecular formula C13H23BO2 and a molecular weight of 222.13 g/mol. IUPAC name: 2-(1-cyclopentylethenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: PHDUGUZNXCBEBI-UHFFFAOYSA-N.
| Molecular formula | C13H23BO2 |
|---|---|
| Molecular weight | 222.13 g/mol |
| IUPAC name | 2-(1-cyclopentylethenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | PHDUGUZNXCBEBI-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C(=C)C2CCCC2 |
Computed by PubChem (NCBI)