CAS 104711-29-7 is the registry number for Methyl 3-methyl-1H-indole-2-carboxylate. Offered by: Chemat. Available pack sizes: 1g.
Methyl 3-methyl-1H-indole-2-carboxylate (CAS 104711-29-7) is a chemical compound with the molecular formula C11H11NO2 and a molecular weight of 189.21 g/mol. IUPAC name: methyl 3-methyl-1H-indole-2-carboxylate. InChIKey: QCVZPYVEGDEHAI-UHFFFAOYSA-N.
| Molecular formula | C11H11NO2 |
|---|---|
| Molecular weight | 189.21 g/mol |
| IUPAC name | methyl 3-methyl-1H-indole-2-carboxylate |
| InChIKey | QCVZPYVEGDEHAI-UHFFFAOYSA-N |
| SMILES | CC1=C(NC2=CC=CC=C12)C(=O)OC |
Computed by PubChem (NCBI)