CAS 1047651-73-9 is the registry number for Trans-4-o-tolylpyrrolidine-3-carboxylic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.
(3S,4R)-4-(2-methylphenyl)pyrrolidine-3-carboxylic acid (CAS 1047651-73-9) is a chemical compound with the molecular formula C12H15NO2 and a molecular weight of 205.25 g/mol. IUPAC name: (3S,4R)-4-(2-methylphenyl)pyrrolidine-3-carboxylic acid. InChIKey: PLUOWDZCCZMKBL-WDEREUQCSA-N.
| Molecular formula | C12H15NO2 |
|---|---|
| Molecular weight | 205.25 g/mol |
| IUPAC name | (3S,4R)-4-(2-methylphenyl)pyrrolidine-3-carboxylic acid |
| InChIKey | PLUOWDZCCZMKBL-WDEREUQCSA-N |
| SMILES | CC1=CC=CC=C1[C@@H]2CNC[C@H]2C(=O)O |
Computed by PubChem (NCBI)