Products 1047651-73-9

CAS 1047651-73-9 is the registry number for Trans-4-o-tolylpyrrolidine-3-carboxylic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

(3S,4R)-4-(2-methylphenyl)pyrrolidine-3-carboxylic acid (CAS 1047651-73-9) is a chemical compound with the molecular formula C12H15NO2 and a molecular weight of 205.25 g/mol. IUPAC name: (3S,4R)-4-(2-methylphenyl)pyrrolidine-3-carboxylic acid. InChIKey: PLUOWDZCCZMKBL-WDEREUQCSA-N.

Identity
Molecular formulaC12H15NO2
Molecular weight205.25 g/mol
IUPAC name(3S,4R)-4-(2-methylphenyl)pyrrolidine-3-carboxylic acid
InChIKeyPLUOWDZCCZMKBL-WDEREUQCSA-N
SMILESCC1=CC=CC=C1[C@@H]2CNC[C@H]2C(=O)O

Computed by PubChem (NCBI)