CAS 1047651-79-5 is the registry number for (3S,4R)-4-(2-Chlorophenyl)pyrrolidine-3-carboxylic acid, 97%. Offered by: AmBeed. Available pack sizes: 1g.
(3S,4R)-4-(2-chlorophenyl)pyrrolidine-3-carboxylic acid (CAS 1047651-79-5) is a chemical compound with the molecular formula C11H12ClNO2 and a molecular weight of 225.67 g/mol. IUPAC name: (3S,4R)-4-(2-chlorophenyl)pyrrolidine-3-carboxylic acid. InChIKey: JGQMSOHBYCXLNS-DTWKUNHWSA-N.
| Molecular formula | C11H12ClNO2 |
|---|---|
| Molecular weight | 225.67 g/mol |
| IUPAC name | (3S,4R)-4-(2-chlorophenyl)pyrrolidine-3-carboxylic acid |
| InChIKey | JGQMSOHBYCXLNS-DTWKUNHWSA-N |
| SMILES | C1[C@H]([C@@H](CN1)C(=O)O)C2=CC=CC=C2Cl |
Computed by PubChem (NCBI)