CAS 104830-07-1 is the registry number for Ethyl 3-(4-amino-3-pyridyl)acrylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Ethyl (E)-3-(4-amino-3-pyridinyl)prop-2-enoate (CAS 104830-07-1) is a chemical compound with the molecular formula C10H12N2O2 and a molecular weight of 192.21 g/mol. IUPAC name: ethyl (E)-3-(4-amino-3-pyridinyl)prop-2-enoate. InChIKey: LYGPATUMODNSAM-ONEGZZNKSA-N.
| Molecular formula | C10H12N2O2 |
|---|---|
| Molecular weight | 192.21 g/mol |
| IUPAC name | ethyl (E)-3-(4-amino-3-pyridinyl)prop-2-enoate |
| InChIKey | LYGPATUMODNSAM-ONEGZZNKSA-N |
| SMILES | CCOC(=O)/C=C/C1=C(C=CN=C1)N |
Computed by PubChem (NCBI)