Products 1048327-84-9
CAS 1048327-84-9 is the registry number for Benzo(1,3)dioxol-5-ylmethyl-phenethyl-amine oxalate. Offered by: Biosynth. Available pack sizes: 250mg, 500mg.
N-(1,3-benzodioxol-5-ylmethyl)-2-phenylethanamine;oxalic acid (CAS 1048327-84-9) is a chemical compound with the molecular formula C18H19NO6 and a molecular weight of 345.3 g/mol. IUPAC name: N-(1,3-benzodioxol-5-ylmethyl)-2-phenylethanamine;oxalic acid. InChIKey: JCIKHRGDOZUNTF-UHFFFAOYSA-N.
| Molecular formula | C18H19NO6 |
|---|---|
| Molecular weight | 345.3 g/mol |
| IUPAC name | N-(1,3-benzodioxol-5-ylmethyl)-2-phenylethanamine;oxalic acid |
| InChIKey | JCIKHRGDOZUNTF-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C=C2)CNCCC3=CC=CC=C3.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)