CAS 1272755-68-6 is the registry number for (S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-hydroxypropanoic acid hydrate, 98%. Offered by: AmBeed. Available pack sizes: 25g.
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-hydroxypropanoic acid;hydrate (CAS 1272755-68-6) is a chemical compound with the molecular formula C18H19NO6 and a molecular weight of 345.3 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-hydroxypropanoic acid;hydrate. InChIKey: RWWKTJDSARSZJL-NTISSMGPSA-N.
| Molecular formula | C18H19NO6 |
|---|---|
| Molecular weight | 345.3 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-hydroxypropanoic acid;hydrate |
| InChIKey | RWWKTJDSARSZJL-NTISSMGPSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CO)C(=O)O.O |
Computed by PubChem (NCBI)