CAS 206649-07-2 is the registry number for 1,2,3-Trimethoxy-5-[(1E)-2-(4-methoxy-3-nitrophenyl)ethenyl]benzene, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1,2,3-trimethoxy-5-[(E)-2-(4-methoxy-3-nitrophenyl)ethenyl]benzene (CAS 206649-07-2) is a chemical compound with the molecular formula C18H19NO6 and a molecular weight of 345.3 g/mol. IUPAC name: 1,2,3-trimethoxy-5-[(E)-2-(4-methoxy-3-nitrophenyl)ethenyl]benzene. InChIKey: PXLJRDOKORMMCA-AATRIKPKSA-N.
| Molecular formula | C18H19NO6 |
|---|---|
| Molecular weight | 345.3 g/mol |
| IUPAC name | 1,2,3-trimethoxy-5-[(E)-2-(4-methoxy-3-nitrophenyl)ethenyl]benzene |
| InChIKey | PXLJRDOKORMMCA-AATRIKPKSA-N |
| SMILES | COC1=C(C=C(C=C1)/C=C/C2=CC(=C(C(=C2)OC)OC)OC)[N+](=O)[O-] |
Computed by PubChem (NCBI)