CAS 143438-95-3 is the registry number for Cusculine. Offered by: MedChemExpress. Available pack sizes: Get quote.
1,2,3,5,6-pentamethoxy-10H-acridin-9-one (CAS 143438-95-3) is a chemical compound with the molecular formula C18H19NO6 and a molecular weight of 345.3 g/mol. IUPAC name: 1,2,3,5,6-pentamethoxy-10H-acridin-9-one. InChIKey: CCYFNSHESGHUKB-UHFFFAOYSA-N.
| Molecular formula | C18H19NO6 |
|---|---|
| Molecular weight | 345.3 g/mol |
| IUPAC name | 1,2,3,5,6-pentamethoxy-10H-acridin-9-one |
| InChIKey | CCYFNSHESGHUKB-UHFFFAOYSA-N |
| SMILES | COC1=C(C2=C(C=C1)C(=O)C3=C(C(=C(C=C3N2)OC)OC)OC)OC |
Computed by PubChem (NCBI)