Products 1048486-24-3
CAS 1048486-24-3 is the registry number for 5-(3,5-Dimethylphenyl)nicotinic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
5-(3,5-dimethylphenyl)pyridine-3-carboxylic acid (CAS 1048486-24-3) is a chemical compound with the molecular formula C14H13NO2 and a molecular weight of 227.26 g/mol. IUPAC name: 5-(3,5-dimethylphenyl)pyridine-3-carboxylic acid. InChIKey: YLLORROYVZRDMN-UHFFFAOYSA-N.
| Molecular formula | C14H13NO2 |
|---|---|
| Molecular weight | 227.26 g/mol |
| IUPAC name | 5-(3,5-dimethylphenyl)pyridine-3-carboxylic acid |
| InChIKey | YLLORROYVZRDMN-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)C2=CC(=CN=C2)C(=O)O)C |
Computed by PubChem (NCBI)