CAS 10485-23-1 appears in our catalog under these names: Carnitine Chloride Impurity 9, 4-Ethoxy-N,N,N-trimethyl-2,4-dioxo-1-butanaminium Chloride. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 1g, 500mg.
[(Z)-4-ethoxy-2-hydroxy-4-oxobut-2-enyl]-trimethylazanium chloride (CAS 10485-23-1) is a chemical compound with the molecular formula C9H18ClNO3 and a molecular weight of 223.70 g/mol. IUPAC name: [(Z)-4-ethoxy-2-hydroxy-4-oxobut-2-enyl]-trimethylazanium chloride. InChIKey: RCMPUKHVPLSFPC-UHFFFAOYSA-N.
| Molecular formula | C9H18ClNO3 |
|---|---|
| Molecular weight | 223.70 g/mol |
| IUPAC name | [(Z)-4-ethoxy-2-hydroxy-4-oxobut-2-enyl]-trimethylazanium chloride |
| InChIKey | RCMPUKHVPLSFPC-UHFFFAOYSA-N |
| SMILES | CCOC(=O)/C=C(/C[N+](C)(C)C)\O.[Cl-] |
Computed by PubChem (NCBI)