Products 2322530-25-4
CAS 2322530-25-4 is the registry number for (S)-3-Methyl-2-morpholinobutanoic acid hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-3-methyl-2-morpholin-4-ylbutanoic acid;hydrochloride (CAS 2322530-25-4) is a chemical compound with the molecular formula C9H18ClNO3 and a molecular weight of 223.70 g/mol. IUPAC name: (2S)-3-methyl-2-morpholin-4-ylbutanoic acid;hydrochloride. InChIKey: QPPAUSAJZFIQBE-QRPNPIFTSA-N.
| Molecular formula | C9H18ClNO3 |
|---|---|
| Molecular weight | 223.70 g/mol |
| IUPAC name | (2S)-3-methyl-2-morpholin-4-ylbutanoic acid;hydrochloride |
| InChIKey | QPPAUSAJZFIQBE-QRPNPIFTSA-N |
| SMILES | CC(C)[C@@H](C(=O)O)N1CCOCC1.Cl |
Computed by PubChem (NCBI)