CAS 177408-65-0 appears in our catalog under these names: 8-Amino-7-oxopelargonic Acid Hydrochloride, >95% (HPLC), KAPA (hydrochloride), KAPA (hydrochloride), (S)-8-Amino-7-oxononanoic acid hydrochloride, ≥98%, ≥98%. Offered by: TRC, TargetMol, GLPBio, Chemat. Available pack sizes: 10mg, 5mg, 50mg, 1mg, 25mg.
(8S)-8-amino-7-oxononanoic acid;hydrochloride (CAS 177408-65-0) is a chemical compound with the molecular formula C9H18ClNO3 and a molecular weight of 223.70 g/mol. IUPAC name: (8S)-8-amino-7-oxononanoic acid;hydrochloride. InChIKey: ZGPOLJARQCHVLY-FJXQXJEOSA-N.
| Molecular formula | C9H18ClNO3 |
|---|---|
| Molecular weight | 223.70 g/mol |
| IUPAC name | (8S)-8-amino-7-oxononanoic acid;hydrochloride |
| InChIKey | ZGPOLJARQCHVLY-FJXQXJEOSA-N |
| SMILES | C[C@@H](C(=O)CCCCCC(=O)O)N.Cl |
Computed by PubChem (NCBI)