Products 1609402-86-9

CAS 1609402-86-9 is the registry number for (4-Isopropyl-2-morpholinyl)acetic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg.

Structural formula: {0} (CAS {1})

2-(4-propan-2-ylmorpholin-2-yl)acetic acid;hydrochloride (CAS 1609402-86-9) is a chemical compound with the molecular formula C9H18ClNO3 and a molecular weight of 223.70 g/mol. IUPAC name: 2-(4-propan-2-ylmorpholin-2-yl)acetic acid;hydrochloride. InChIKey: UBAXAEZSYFKFAX-UHFFFAOYSA-N.

Identity
Molecular formulaC9H18ClNO3
Molecular weight223.70 g/mol
IUPAC name2-(4-propan-2-ylmorpholin-2-yl)acetic acid;hydrochloride
InChIKeyUBAXAEZSYFKFAX-UHFFFAOYSA-N
SMILESCC(C)N1CCOC(C1)CC(=O)O.Cl

Computed by PubChem (NCBI)