CAS 104864-11-1 appears in our catalog under these names: [2-(1,3-Benzoxazol-2-ylthio)ethyl]amine hydrochloride, 95%, 2-(Benzo(d)oxazol-2-ylthio)ethanamine hydrochloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 10g, 50g, 1g, 5g.
2-(1,3-benzoxazol-2-ylsulfanyl)ethanamine;hydrochloride (CAS 104864-11-1) is a chemical compound with the molecular formula C9H11ClN2OS and a molecular weight of 230.72 g/mol. IUPAC name: 2-(1,3-benzoxazol-2-ylsulfanyl)ethanamine;hydrochloride. InChIKey: GUWFUWJYOGCEDJ-UHFFFAOYSA-N.
| Molecular formula | C9H11ClN2OS |
|---|---|
| Molecular weight | 230.72 g/mol |
| IUPAC name | 2-(1,3-benzoxazol-2-ylsulfanyl)ethanamine;hydrochloride |
| InChIKey | GUWFUWJYOGCEDJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=C(O2)SCCN.Cl |
Computed by PubChem (NCBI)