CAS 465515-36-0 appears in our catalog under these names: 1-Benzothiophene-3-carboximidamidine, hydrochloride hydrate, 95%, Benzo(b)thiophene-3-carboxamidine Hydrochloride Hydrate, 1-Benzothiophene-3-carboximidamidine hydrochloride, 97% . Offered by: Combi-blocks, TRC, Thermo Scientific. Available pack sizes: 250mg, 1g, 100mg, 500mg, 10g.
1-benzothiophene-3-carboximidamide;hydrate;hydrochloride (CAS 465515-36-0) is a chemical compound with the molecular formula C9H11ClN2OS and a molecular weight of 230.72 g/mol. IUPAC name: 1-benzothiophene-3-carboximidamide;hydrate;hydrochloride. InChIKey: DCDNRDYUSJNDGA-UHFFFAOYSA-N.
| Molecular formula | C9H11ClN2OS |
|---|---|
| Molecular weight | 230.72 g/mol |
| IUPAC name | 1-benzothiophene-3-carboximidamide;hydrate;hydrochloride |
| InChIKey | DCDNRDYUSJNDGA-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CS2)C(=N)N.O.Cl |
Computed by PubChem (NCBI)