CAS 1306605-78-6 is the registry number for 2-(2-Aminoethoxy)-1,3-benzothiazole hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-(1,3-benzothiazol-2-yloxy)ethanamine;hydrochloride (CAS 1306605-78-6) is a chemical compound with the molecular formula C9H11ClN2OS and a molecular weight of 230.72 g/mol. IUPAC name: 2-(1,3-benzothiazol-2-yloxy)ethanamine;hydrochloride. InChIKey: WDUCGYGACGWHLT-UHFFFAOYSA-N.
| Molecular formula | C9H11ClN2OS |
|---|---|
| Molecular weight | 230.72 g/mol |
| IUPAC name | 2-(1,3-benzothiazol-2-yloxy)ethanamine;hydrochloride |
| InChIKey | WDUCGYGACGWHLT-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=C(S2)OCCN.Cl |
Computed by PubChem (NCBI)