CAS 1306603-84-8 appears in our catalog under these names: N-(4-(Chloromethyl)-1,3-thiazol-2-yl)-N-cyclopropylacetamide, 95%, N-(4-(Chloromethyl)-1,3-thiazol-2-yl)-N-cyclopropylacetamide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.
N-[4-(chloromethyl)-1,3-thiazol-2-yl]-N-cyclopropylacetamide (CAS 1306603-84-8) is a chemical compound with the molecular formula C9H11ClN2OS and a molecular weight of 230.72 g/mol. IUPAC name: N-[4-(chloromethyl)-1,3-thiazol-2-yl]-N-cyclopropylacetamide. InChIKey: ORMXNHDRBMVEGN-UHFFFAOYSA-N.
| Molecular formula | C9H11ClN2OS |
|---|---|
| Molecular weight | 230.72 g/mol |
| IUPAC name | N-[4-(chloromethyl)-1,3-thiazol-2-yl]-N-cyclopropylacetamide |
| InChIKey | ORMXNHDRBMVEGN-UHFFFAOYSA-N |
| SMILES | CC(=O)N(C1CC1)C2=NC(=CS2)CCl |
Computed by PubChem (NCBI)