CAS 1048640-57-8 is the registry number for N-(2,4-Dichlorobenzyl)-1-phenylethanamine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
N-[(2,4-dichlorophenyl)methyl]-1-phenylethanamine;hydrochloride (CAS 1048640-57-8) is a chemical compound with the molecular formula C15H16Cl3N and a molecular weight of 316.6 g/mol. IUPAC name: N-[(2,4-dichlorophenyl)methyl]-1-phenylethanamine;hydrochloride. InChIKey: RPPMWXMWVIFOBC-UHFFFAOYSA-N.
| Molecular formula | C15H16Cl3N |
|---|---|
| Molecular weight | 316.6 g/mol |
| IUPAC name | N-[(2,4-dichlorophenyl)methyl]-1-phenylethanamine;hydrochloride |
| InChIKey | RPPMWXMWVIFOBC-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=CC=C1)NCC2=C(C=C(C=C2)Cl)Cl.Cl |
Computed by PubChem (NCBI)