CAS 1375968-68-5 is the registry number for 1,3-Bis(4-chlorophenyl)propan-2-amine hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
1,3-bis(4-chlorophenyl)propan-2-amine;hydrochloride (CAS 1375968-68-5) is a chemical compound with the molecular formula C15H16Cl3N and a molecular weight of 316.6 g/mol. IUPAC name: 1,3-bis(4-chlorophenyl)propan-2-amine;hydrochloride. InChIKey: IVQYYLHITBWPEJ-UHFFFAOYSA-N.
| Molecular formula | C15H16Cl3N |
|---|---|
| Molecular weight | 316.6 g/mol |
| IUPAC name | 1,3-bis(4-chlorophenyl)propan-2-amine;hydrochloride |
| InChIKey | IVQYYLHITBWPEJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CC(CC2=CC=C(C=C2)Cl)N)Cl.Cl |
Computed by PubChem (NCBI)