CAS 2229135-08-2 is the registry number for 1-(3,4-Dichlorophenyl)-3-phenylpropan-1-amine hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-(3,4-dichlorophenyl)-3-phenylpropan-1-amine;hydrochloride (CAS 2229135-08-2) is a chemical compound with the molecular formula C15H16Cl3N and a molecular weight of 316.6 g/mol. IUPAC name: 1-(3,4-dichlorophenyl)-3-phenylpropan-1-amine;hydrochloride. InChIKey: CAEYNSKDDNQEDG-UHFFFAOYSA-N.
| Molecular formula | C15H16Cl3N |
|---|---|
| Molecular weight | 316.6 g/mol |
| IUPAC name | 1-(3,4-dichlorophenyl)-3-phenylpropan-1-amine;hydrochloride |
| InChIKey | CAEYNSKDDNQEDG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CCC(C2=CC(=C(C=C2)Cl)Cl)N.Cl |
Computed by PubChem (NCBI)