CAS 1185292-72-1 is the registry number for N,N-Bis(3-chlorobenzyl)methylamine hydrochloride, 97%, 97%. Offered by: Chemat. Available pack sizes: 5g, 10g.
1-(3-chlorophenyl)-N-[(3-chlorophenyl)methyl]-N-methylmethanamine;hydrochloride (CAS 1185292-72-1) is a chemical compound with the molecular formula C15H16Cl3N and a molecular weight of 316.6 g/mol. IUPAC name: 1-(3-chlorophenyl)-N-[(3-chlorophenyl)methyl]-N-methylmethanamine;hydrochloride. InChIKey: DBIVSHWAUZSFMC-UHFFFAOYSA-N.
| Molecular formula | C15H16Cl3N |
|---|---|
| Molecular weight | 316.6 g/mol |
| IUPAC name | 1-(3-chlorophenyl)-N-[(3-chlorophenyl)methyl]-N-methylmethanamine;hydrochloride |
| InChIKey | DBIVSHWAUZSFMC-UHFFFAOYSA-N |
| SMILES | CN(CC1=CC(=CC=C1)Cl)CC2=CC(=CC=C2)Cl.Cl |
Computed by PubChem (NCBI)