CAS 1048664-12-5 is the registry number for [2-(mesityloxy)ethyl]amine hydrochloride, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
2-(2,4,6-trimethylphenoxy)ethanamine;hydrochloride (CAS 1048664-12-5) is a chemical compound with the molecular formula C11H18ClNO and a molecular weight of 215.72 g/mol. IUPAC name: 2-(2,4,6-trimethylphenoxy)ethanamine;hydrochloride. InChIKey: RVNZKJGDJRVGES-UHFFFAOYSA-N.
| Molecular formula | C11H18ClNO |
|---|---|
| Molecular weight | 215.72 g/mol |
| IUPAC name | 2-(2,4,6-trimethylphenoxy)ethanamine;hydrochloride |
| InChIKey | RVNZKJGDJRVGES-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)OCCN)C.Cl |
Computed by PubChem (NCBI)