CAS 10487-31-7 appears in our catalog under these names: 1-Isopropyl-1h-indole-2,3-dione, 95%, 1-Isopropyl-1H-indole-2,3-dione. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 250mg, 10g, 0,5g.
1-propan-2-ylindole-2,3-dione (CAS 10487-31-7) is a chemical compound with the molecular formula C11H11NO2 and a molecular weight of 189.21 g/mol. IUPAC name: 1-propan-2-ylindole-2,3-dione. InChIKey: QBLFUHJXULERAQ-UHFFFAOYSA-N.
| Molecular formula | C11H11NO2 |
|---|---|
| Molecular weight | 189.21 g/mol |
| IUPAC name | 1-propan-2-ylindole-2,3-dione |
| InChIKey | QBLFUHJXULERAQ-UHFFFAOYSA-N |
| SMILES | CC(C)N1C2=CC=CC=C2C(=O)C1=O |
Computed by PubChem (NCBI)