Products 104876-35-9

CAS 104876-35-9 is the registry number for Ethyl 2-cyano-2-methyl-3-phenylpropanoate. Offered by: Biosynth. Available pack sizes: 1g, 100mg.

Structural formula: {0} (CAS {1})

Ethyl 2-cyano-2-methyl-3-phenylpropanoate (CAS 104876-35-9) is a chemical compound with the molecular formula C13H15NO2 and a molecular weight of 217.26 g/mol. IUPAC name: ethyl 2-cyano-2-methyl-3-phenylpropanoate. InChIKey: REKQIBZXKNXEAX-UHFFFAOYSA-N.

Identity
Molecular formulaC13H15NO2
Molecular weight217.26 g/mol
IUPAC nameethyl 2-cyano-2-methyl-3-phenylpropanoate
InChIKeyREKQIBZXKNXEAX-UHFFFAOYSA-N
SMILESCCOC(=O)C(C)(CC1=CC=CC=C1)C#N

Computed by PubChem (NCBI)