CAS 1048963-21-8 appears in our catalog under these names: (1S,2R,4R)-7-oxabicyclo(2.2.1)heptane-2-carboxylic acid, 98%, (1S,2R,4R)-7-Oxabicyclo(2.2.1)heptane-2-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 2,5g.
(1S,2R,4R)-7-oxabicyclo[2.2.1]heptane-2-carboxylic acid (CAS 1048963-21-8) is a chemical compound with the molecular formula C7H10O3 and a molecular weight of 142.15 g/mol. IUPAC name: (1S,2R,4R)-7-oxabicyclo[2.2.1]heptane-2-carboxylic acid. InChIKey: UYLYISCHTFVYHN-PBXRRBTRSA-N.
| Molecular formula | C7H10O3 |
|---|---|
| Molecular weight | 142.15 g/mol |
| IUPAC name | (1S,2R,4R)-7-oxabicyclo[2.2.1]heptane-2-carboxylic acid |
| InChIKey | UYLYISCHTFVYHN-PBXRRBTRSA-N |
| SMILES | C1C[C@H]2[C@@H](C[C@@H]1O2)C(=O)O |
Computed by PubChem (NCBI)