CAS 38263-55-7 appears in our catalog under these names: rel-(1R,2R,4S)-7-oxabicyclo[2.2.1]heptane-2-carboxylic acid, 98+%, 98+%, rel-(1R,2R,4S)-7-oxabicyclo[2.2.1]heptane-2-carboxylic acid, 98+%. Offered by: Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
(1R,2R,4S)-7-oxabicyclo[2.2.1]heptane-2-carboxylic acid (CAS 38263-55-7) is a chemical compound with the molecular formula C7H10O3 and a molecular weight of 142.15 g/mol. IUPAC name: (1R,2R,4S)-7-oxabicyclo[2.2.1]heptane-2-carboxylic acid. InChIKey: UYLYISCHTFVYHN-KVQBGUIXSA-N.
| Molecular formula | C7H10O3 |
|---|---|
| Molecular weight | 142.15 g/mol |
| IUPAC name | (1R,2R,4S)-7-oxabicyclo[2.2.1]heptane-2-carboxylic acid |
| InChIKey | UYLYISCHTFVYHN-KVQBGUIXSA-N |
| SMILES | C1C[C@@H]2[C@@H](C[C@H]1O2)C(=O)O |
Computed by PubChem (NCBI)