CAS 38263-56-8 appears in our catalog under these names: rel-(1R,2S,4S)-7-Oxabicyclo(2.2.1)heptane-2-carboxylic acid, 97%, rel–(1R,2S,4S)–7–Oxabicyclo(2·2·1)heptane–2–carboxylic acid, (1R,2S,4S)-rel-7-Oxabicyclo(2.2.1)heptane-2-carboxylic acid, (1R,2S,4S)-7-Oxabicyclo[2.2.1]heptan-2-exo-carboxylic acid, 97%, 97%. Offered by: AmBeed, GLPBio, Biosynth, Chemat. Available pack sizes: 10g, 5g, 100mg, 1g, 250mg, 500mg.
(1R,2S,4S)-7-oxabicyclo[2.2.1]heptane-2-carboxylic acid (CAS 38263-56-8) is a chemical compound with the molecular formula C7H10O3 and a molecular weight of 142.15 g/mol. IUPAC name: (1R,2S,4S)-7-oxabicyclo[2.2.1]heptane-2-carboxylic acid. InChIKey: UYLYISCHTFVYHN-HCWXCVPCSA-N.
| Molecular formula | C7H10O3 |
|---|---|
| Molecular weight | 142.15 g/mol |
| IUPAC name | (1R,2S,4S)-7-oxabicyclo[2.2.1]heptane-2-carboxylic acid |
| InChIKey | UYLYISCHTFVYHN-HCWXCVPCSA-N |
| SMILES | C1C[C@@H]2[C@H](C[C@H]1O2)C(=O)O |
Computed by PubChem (NCBI)