Products 1048963-34-3

CAS 1048963-34-3 appears in our catalog under these names: 2,2-Difluoro-2-(tetrahydro-2H-pyran-4-yl)acetic acid, 98%, 2,2-Difluoro-2-(oxan-4-yl)acetic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 250mg, 1g, 50mg, 0,5g.

Structural formula: {0} (CAS {1})

2,2-difluoro-2-(oxan-4-yl)acetic acid (CAS 1048963-34-3) is a chemical compound with the molecular formula C7H10F2O3 and a molecular weight of 180.15 g/mol. IUPAC name: 2,2-difluoro-2-(oxan-4-yl)acetic acid. InChIKey: KSQYYBYUWBXIBC-UHFFFAOYSA-N.

Identity
Molecular formulaC7H10F2O3
Molecular weight180.15 g/mol
IUPAC name2,2-difluoro-2-(oxan-4-yl)acetic acid
InChIKeyKSQYYBYUWBXIBC-UHFFFAOYSA-N
SMILESC1COCCC1C(C(=O)O)(F)F

Computed by PubChem (NCBI)