Products 681240-10-8

CAS 681240-10-8 is the registry number for 2,2-Difluoro-2-(1-hydroxycyclopentyl)acetic acid, 97%. Offered by: AmBeed. Available pack sizes: 1g, 10g, 5g.

2,2-difluoro-2-(1-hydroxycyclopentyl)acetic acid (CAS 681240-10-8) is a chemical compound with the molecular formula C7H10F2O3 and a molecular weight of 180.15 g/mol. IUPAC name: 2,2-difluoro-2-(1-hydroxycyclopentyl)acetic acid. InChIKey: BJPRDLSLGRZMSC-UHFFFAOYSA-N.

Identity
Molecular formulaC7H10F2O3
Molecular weight180.15 g/mol
IUPAC name2,2-difluoro-2-(1-hydroxycyclopentyl)acetic acid
InChIKeyBJPRDLSLGRZMSC-UHFFFAOYSA-N
SMILESC1CCC(C1)(C(C(=O)O)(F)F)O

Computed by PubChem (NCBI)