CAS 681240-10-8 is the registry number for 2,2-Difluoro-2-(1-hydroxycyclopentyl)acetic acid, 97%. Offered by: AmBeed. Available pack sizes: 1g, 10g, 5g.
2,2-difluoro-2-(1-hydroxycyclopentyl)acetic acid (CAS 681240-10-8) is a chemical compound with the molecular formula C7H10F2O3 and a molecular weight of 180.15 g/mol. IUPAC name: 2,2-difluoro-2-(1-hydroxycyclopentyl)acetic acid. InChIKey: BJPRDLSLGRZMSC-UHFFFAOYSA-N.
| Molecular formula | C7H10F2O3 |
|---|---|
| Molecular weight | 180.15 g/mol |
| IUPAC name | 2,2-difluoro-2-(1-hydroxycyclopentyl)acetic acid |
| InChIKey | BJPRDLSLGRZMSC-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)(C(C(=O)O)(F)F)O |
Computed by PubChem (NCBI)