Products 2817753-15-2

CAS 2817753-15-2 is the registry number for 2-(4,4-Difluorotetrahydro-2H-pyran-2-yl)acetic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

2-(4,4-difluorooxan-2-yl)acetic acid (CAS 2817753-15-2) is a chemical compound with the molecular formula C7H10F2O3 and a molecular weight of 180.15 g/mol. IUPAC name: 2-(4,4-difluorooxan-2-yl)acetic acid. InChIKey: DJPXQYPKFPSQHF-UHFFFAOYSA-N.

Identity
Molecular formulaC7H10F2O3
Molecular weight180.15 g/mol
IUPAC name2-(4,4-difluorooxan-2-yl)acetic acid
InChIKeyDJPXQYPKFPSQHF-UHFFFAOYSA-N
SMILESC1COC(CC1(F)F)CC(=O)O

Computed by PubChem (NCBI)