Products 2477877-45-3

CAS 2477877-45-3 is the registry number for Rel-(1s,3s)-3-(difluoromethoxy)-3-methylcyclobutane-1-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

3-(difluoromethoxy)-3-methylcyclobutane-1-carboxylic acid (CAS 2477877-45-3) is a chemical compound with the molecular formula C7H10F2O3 and a molecular weight of 180.15 g/mol. IUPAC name: 3-(difluoromethoxy)-3-methylcyclobutane-1-carboxylic acid. InChIKey: HXDRMRXJLXRNIH-UHFFFAOYSA-N.

Identity
Molecular formulaC7H10F2O3
Molecular weight180.15 g/mol
IUPAC name3-(difluoromethoxy)-3-methylcyclobutane-1-carboxylic acid
InChIKeyHXDRMRXJLXRNIH-UHFFFAOYSA-N
SMILESCC1(CC(C1)C(=O)O)OC(F)F

Computed by PubChem (NCBI)