CAS 1048971-67-0 appears in our catalog under these names: 1-Cyclohexyl-1-tosylmethyl Isocyanide, >95% (HPLC), 1-Cyclohexyl-1-tosylmethyl isocyanide, 1-Cyclohexyl-1-tosylmethyl isocyanide, min. 95 %, 500 mg, 1-Cyclohexyl-1-tosylmethyl isocyanide, min. 95 %, 1 g. Offered by: TRC, Biosynth, Roth. Available pack sizes: 100mg, 1g, 500mg, 1000mg.
1-[cyclohexyl(isocyano)methyl]sulfonyl-4-methylbenzene (CAS 1048971-67-0) is a chemical compound with the molecular formula C15H19NO2S and a molecular weight of 277.4 g/mol. IUPAC name: 1-[cyclohexyl(isocyano)methyl]sulfonyl-4-methylbenzene. InChIKey: BGVZZOZWXDWACP-UHFFFAOYSA-N.
| Molecular formula | C15H19NO2S |
|---|---|
| Molecular weight | 277.4 g/mol |
| IUPAC name | 1-[cyclohexyl(isocyano)methyl]sulfonyl-4-methylbenzene |
| InChIKey | BGVZZOZWXDWACP-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)C(C2CCCCC2)[N+]#[C-] |
Computed by PubChem (NCBI)