CAS 1354407-57-0 is the registry number for 2-(Adamantan-1-yl)-4-methylthiazole-5-carboxylic acid, 97%. Offered by: AmBeed. Available pack sizes: 250mg, 1g.
2-(1-adamantyl)-4-methyl-1,3-thiazole-5-carboxylic acid (CAS 1354407-57-0) is a chemical compound with the molecular formula C15H19NO2S and a molecular weight of 277.4 g/mol. IUPAC name: 2-(1-adamantyl)-4-methyl-1,3-thiazole-5-carboxylic acid. InChIKey: GQVDXTCTMCYLQZ-UHFFFAOYSA-N.
| Molecular formula | C15H19NO2S |
|---|---|
| Molecular weight | 277.4 g/mol |
| IUPAC name | 2-(1-adamantyl)-4-methyl-1,3-thiazole-5-carboxylic acid |
| InChIKey | GQVDXTCTMCYLQZ-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=N1)C23CC4CC(C2)CC(C4)C3)C(=O)O |
Computed by PubChem (NCBI)