CAS 868613-81-4 is the registry number for Rel-N-((1R,2S)-2-ethynylcyclohexyl)-4-methylbenzenesulfonamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-[(1R,2S)-2-ethynylcyclohexyl]-4-methylbenzenesulfonamide (CAS 868613-81-4) is a chemical compound with the molecular formula C15H19NO2S and a molecular weight of 277.4 g/mol. IUPAC name: N-[(1R,2S)-2-ethynylcyclohexyl]-4-methylbenzenesulfonamide. InChIKey: WPTZWSCXMHUQKW-UKRRQHHQSA-N.
| Molecular formula | C15H19NO2S |
|---|---|
| Molecular weight | 277.4 g/mol |
| IUPAC name | N-[(1R,2S)-2-ethynylcyclohexyl]-4-methylbenzenesulfonamide |
| InChIKey | WPTZWSCXMHUQKW-UKRRQHHQSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N[C@@H]2CCCC[C@H]2C#C |
Computed by PubChem (NCBI)