Products 2891580-82-6
CAS 2891580-82-6 is the registry number for 8-[(1S)-1-aminoethyl]-2-ethylsulfanyl-3,6-dimethyl-chromen-4-one, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg.
8-[(1S)-1-aminoethyl]-2-ethylsulfanyl-3,6-dimethylchromen-4-one (CAS 2891580-82-6) is a chemical compound with the molecular formula C15H19NO2S and a molecular weight of 277.4 g/mol. IUPAC name: 8-[(1S)-1-aminoethyl]-2-ethylsulfanyl-3,6-dimethylchromen-4-one. InChIKey: YZDCPNAOQXSHPL-JTQLQIEISA-N.
| Molecular formula | C15H19NO2S |
|---|---|
| Molecular weight | 277.4 g/mol |
| IUPAC name | 8-[(1S)-1-aminoethyl]-2-ethylsulfanyl-3,6-dimethylchromen-4-one |
| InChIKey | YZDCPNAOQXSHPL-JTQLQIEISA-N |
| SMILES | CCSC1=C(C(=O)C2=C(O1)C(=CC(=C2)C)[C@H](C)N)C |
Computed by PubChem (NCBI)