CAS 1049148-10-8 appears in our catalog under these names: tert-Butyl (1,1-dioxido-2,3-dihydrothiophen-3-yl)carbamate, 95%, tert-Butyl N-(1,1-dioxo-2,3-dihydro-1λâ¶-thiophen-3-yl)carbamate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
Tert-butyl N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)carbamate (CAS 1049148-10-8) is a chemical compound with the molecular formula C9H15NO4S and a molecular weight of 233.29 g/mol. IUPAC name: tert-butyl N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)carbamate. InChIKey: YNVKZWXOINQFRR-UHFFFAOYSA-N.
| Molecular formula | C9H15NO4S |
|---|---|
| Molecular weight | 233.29 g/mol |
| IUPAC name | tert-butyl N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)carbamate |
| InChIKey | YNVKZWXOINQFRR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1CS(=O)(=O)C=C1 |
Computed by PubChem (NCBI)