CAS 10495-73-5 appears in our catalog under these names: 6-Bromo-2,2’-bipyridine, 6–Bromo–2,2'–bipyridyl, 6-Bromo-2,2'-bipyridyl, >97.0%(GC), 6-Bromo-2,2'-bipyridine 97%, 6-BROMO-2,2'-BIPYRIDINE. Offered by: TRC, GLPBio, TCI, Ambeed, Sigma-Aldrich. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g, 100mg, 250mg, 100g.
2-bromo-6-pyridin-2-ylpyridine (CAS 10495-73-5) is a chemical compound with the molecular formula C10H7BrN2 and a molecular weight of 235.08 g/mol. IUPAC name: 2-bromo-6-pyridin-2-ylpyridine. InChIKey: NCRIDSGPLISUEU-UHFFFAOYSA-N.
| Molecular formula | C10H7BrN2 |
|---|---|
| Molecular weight | 235.08 g/mol |
| IUPAC name | 2-bromo-6-pyridin-2-ylpyridine |
| InChIKey | NCRIDSGPLISUEU-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)C2=NC(=CC=C2)Br |
Computed by PubChem (NCBI)