CAS 3543-46-2 appears in our catalog under these names: 5-Bromo-4-phenylpyrimidine, 98%, 5–Bromo–4–phenylpyrimidine. Offered by: Combi-blocks, GLPBio. Available pack sizes: 5g, 250mg, 1g, 100mg.
5-bromo-4-phenylpyrimidine (CAS 3543-46-2) is a chemical compound with the molecular formula C10H7BrN2 and a molecular weight of 235.08 g/mol. IUPAC name: 5-bromo-4-phenylpyrimidine. InChIKey: SDPYFZLDWYNXJF-UHFFFAOYSA-N.
| Molecular formula | C10H7BrN2 |
|---|---|
| Molecular weight | 235.08 g/mol |
| IUPAC name | 5-bromo-4-phenylpyrimidine |
| InChIKey | SDPYFZLDWYNXJF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC=NC=C2Br |
Computed by PubChem (NCBI)