CAS 774-53-8 appears in our catalog under these names: 5-Bromo-2,3'-bipyridine, 95%, 5-Bromo-2,3'-bipyridine, 97%, 5-Bromo-2,3'-bipyridine, 95% , 5-Bromo-(2,3')bipyridinyl, 5-Bromo-2,3'-bipyridine, 98%, 98%. Offered by: Combi-blocks, AmBeed, Thermo Scientific (Alfa Aesar), Biosynth, Chemat. Available pack sizes: 250mg, 1g, 5g, 0,5g, 50mg, 100mg.
5-bromo-2-pyridin-3-ylpyridine (CAS 774-53-8) is a chemical compound with the molecular formula C10H7BrN2 and a molecular weight of 235.08 g/mol. IUPAC name: 5-bromo-2-pyridin-3-ylpyridine. InChIKey: ILJRIAPZWHYPMK-UHFFFAOYSA-N.
| Molecular formula | C10H7BrN2 |
|---|---|
| Molecular weight | 235.08 g/mol |
| IUPAC name | 5-bromo-2-pyridin-3-ylpyridine |
| InChIKey | ILJRIAPZWHYPMK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)C2=NC=C(C=C2)Br |
Computed by PubChem (NCBI)