CAS 1521852-53-8 is the registry number for 1H-Indole-3-carbonitrile, 4-bromo-1-methyl-, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
4-bromo-1-methylindole-3-carbonitrile (CAS 1521852-53-8) is a chemical compound with the molecular formula C10H7BrN2 and a molecular weight of 235.08 g/mol. IUPAC name: 4-bromo-1-methylindole-3-carbonitrile. InChIKey: LHRJRXQECMWIGM-UHFFFAOYSA-N.
| Molecular formula | C10H7BrN2 |
|---|---|
| Molecular weight | 235.08 g/mol |
| IUPAC name | 4-bromo-1-methylindole-3-carbonitrile |
| InChIKey | LHRJRXQECMWIGM-UHFFFAOYSA-N |
| SMILES | CN1C=C(C2=C1C=CC=C2Br)C#N |
Computed by PubChem (NCBI)