CAS 1049604-97-8 is the registry number for 3-(2-Chloroacetamido)-N,N-dimethylbenzamide, 95%. Offered by: AmBeed. Available pack sizes: 5g.
3-[(2-chloroacetyl)amino]-N,N-dimethylbenzamide (CAS 1049604-97-8) is a chemical compound with the molecular formula C11H13ClN2O2 and a molecular weight of 240.68 g/mol. IUPAC name: 3-[(2-chloroacetyl)amino]-N,N-dimethylbenzamide. InChIKey: CAPONPDCOFTECB-UHFFFAOYSA-N.
| Molecular formula | C11H13ClN2O2 |
|---|---|
| Molecular weight | 240.68 g/mol |
| IUPAC name | 3-[(2-chloroacetyl)amino]-N,N-dimethylbenzamide |
| InChIKey | CAPONPDCOFTECB-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)C1=CC(=CC=C1)NC(=O)CCl |
Computed by PubChem (NCBI)