Products 1049606-26-9
CAS 1049606-26-9 is the registry number for 2-Chloro-N-(5-cyclopropyl-1,3,4-oxadiazol-2-yl)acetamide. Offered by: Biosynth. Available pack sizes: 0,5g, 5g.
2-chloro-N-(5-cyclopropyl-1,3,4-oxadiazol-2-yl)acetamide (CAS 1049606-26-9) is a chemical compound with the molecular formula C7H8ClN3O2 and a molecular weight of 201.61 g/mol. IUPAC name: 2-chloro-N-(5-cyclopropyl-1,3,4-oxadiazol-2-yl)acetamide. InChIKey: QNGRBBRNODNUHS-UHFFFAOYSA-N.
| Molecular formula | C7H8ClN3O2 |
|---|---|
| Molecular weight | 201.61 g/mol |
| IUPAC name | 2-chloro-N-(5-cyclopropyl-1,3,4-oxadiazol-2-yl)acetamide |
| InChIKey | QNGRBBRNODNUHS-UHFFFAOYSA-N |
| SMILES | C1CC1C2=NN=C(O2)NC(=O)CCl |
Computed by PubChem (NCBI)