CAS 1049637-71-9 is the registry number for methanesulfonic acid (R)–(1–aza–bicyclo(2·2·2)oct–3–yl) ester. Offered by: GLPBio. Available pack sizes: 200mg.
[(3R)-1-azabicyclo[2.2.2]octan-3-yl] methanesulfonate (CAS 1049637-71-9) is a chemical compound with the molecular formula C8H15NO3S and a molecular weight of 205.28 g/mol. IUPAC name: [(3R)-1-azabicyclo[2.2.2]octan-3-yl] methanesulfonate. InChIKey: QVEMSVFKCNTWFF-QMMMGPOBSA-N.
| Molecular formula | C8H15NO3S |
|---|---|
| Molecular weight | 205.28 g/mol |
| IUPAC name | [(3R)-1-azabicyclo[2.2.2]octan-3-yl] methanesulfonate |
| InChIKey | QVEMSVFKCNTWFF-QMMMGPOBSA-N |
| SMILES | CS(=O)(=O)O[C@H]1CN2CCC1CC2 |
Computed by PubChem (NCBI)