CAS 342780-56-7 is the registry number for N-(1,1-Dioxidotetrahydrothiophen-3-yl)isobutyramide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(1,1-dioxothiolan-3-yl)-2-methylpropanamide (CAS 342780-56-7) is a chemical compound with the molecular formula C8H15NO3S and a molecular weight of 205.28 g/mol. IUPAC name: N-(1,1-dioxothiolan-3-yl)-2-methylpropanamide. InChIKey: CMRCRFRJINUHQR-UHFFFAOYSA-N.
| Molecular formula | C8H15NO3S |
|---|---|
| Molecular weight | 205.28 g/mol |
| IUPAC name | N-(1,1-dioxothiolan-3-yl)-2-methylpropanamide |
| InChIKey | CMRCRFRJINUHQR-UHFFFAOYSA-N |
| SMILES | CC(C)C(=O)NC1CCS(=O)(=O)C1 |
Computed by PubChem (NCBI)