Products 52811-70-8

CAS 52811-70-8 is the registry number for 4-(Methylsulfanyl)-2-propanamidobutanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

4-methylsulfanyl-2-(propanoylamino)butanoic acid (CAS 52811-70-8) is a chemical compound with the molecular formula C8H15NO3S and a molecular weight of 205.28 g/mol. IUPAC name: 4-methylsulfanyl-2-(propanoylamino)butanoic acid. InChIKey: RBAAEQRITQHPJM-UHFFFAOYSA-N.

Identity
Molecular formulaC8H15NO3S
Molecular weight205.28 g/mol
IUPAC name4-methylsulfanyl-2-(propanoylamino)butanoic acid
InChIKeyRBAAEQRITQHPJM-UHFFFAOYSA-N
SMILESCCC(=O)NC(CCSC)C(=O)O

Computed by PubChem (NCBI)