CAS 1881976-38-0 is the registry number for 3-(((3-Methyloxetan-3-yl)methyl)amino)thietane 1,1-dioxide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
N-[(3-methyloxetan-3-yl)methyl]-1,1-dioxothietan-3-amine (CAS 1881976-38-0) is a chemical compound with the molecular formula C8H15NO3S and a molecular weight of 205.28 g/mol. IUPAC name: N-[(3-methyloxetan-3-yl)methyl]-1,1-dioxothietan-3-amine. InChIKey: CNZQZFSFYAHFGK-UHFFFAOYSA-N.
| Molecular formula | C8H15NO3S |
|---|---|
| Molecular weight | 205.28 g/mol |
| IUPAC name | N-[(3-methyloxetan-3-yl)methyl]-1,1-dioxothietan-3-amine |
| InChIKey | CNZQZFSFYAHFGK-UHFFFAOYSA-N |
| SMILES | CC1(COC1)CNC2CS(=O)(=O)C2 |
Computed by PubChem (NCBI)