Products 104967-35-3

CAS 104967-35-3 is the registry number for [3-(Chlorosulfonyl)-4-methoxyphenyl]acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

2-(3-chlorosulfonyl-4-methoxyphenyl)acetic acid (CAS 104967-35-3) is a chemical compound with the molecular formula C9H9ClO5S and a molecular weight of 264.68 g/mol. IUPAC name: 2-(3-chlorosulfonyl-4-methoxyphenyl)acetic acid. InChIKey: FYIDPDFPNMMBIH-UHFFFAOYSA-N.

Identity
Molecular formulaC9H9ClO5S
Molecular weight264.68 g/mol
IUPAC name2-(3-chlorosulfonyl-4-methoxyphenyl)acetic acid
InChIKeyFYIDPDFPNMMBIH-UHFFFAOYSA-N
SMILESCOC1=C(C=C(C=C1)CC(=O)O)S(=O)(=O)Cl

Computed by PubChem (NCBI)